https://en.bharatpedia.org/w/index.php?action=history&feed=atom&title=Butachlor
Butachlor - Revision history
2026-10-20T14:57:36Z
Revision history for this page on the wiki
MediaWiki 1.43.6
https://en.bharatpedia.org/w/index.php?title=Butachlor&diff=192548&oldid=prev
>LegionMammal978: move PIN
2021-05-02T03:26:17Z
<p>move PIN</p>
<p><b>New page</b></p><div>{{Chembox<br />
| ImageFile = butachlor structure.svg<br />
| ImageSize = <br />
| PIN = ''N''-(Butoxymethyl)-2-chloro-''N''-(2,6-diethylphenyl)acetamide<br />
| OtherNames = <br />
|Section1={{Chembox Identifiers<br />
| CASNo = 23184-66-9<br />
| CASNo_Ref = {{cascite|correct|CAS}}<br />
| PubChem = 31677<br />
| ChEMBL = 1399036<br />
| ChEBI_Ref = {{ebicite|correct|EBI}} <br />
| ChEBI = 3230<br />
| ChemSpiderID = 29376<br />
| EINECS = 245-477-8<br />
| KEGG = C10931<br />
| UNII = 94NU90OO5K<br />
| SMILES = ClCC(=O)N(c1c(cccc1CC)CC)COCCCC<br />
| InChI =1S/C17H26ClNO2/c1-4-7-11-21-13-19(16(20)12-18)17-14(5-2)9-8-10-15(17)6-3/h8-10H,4-7,11-13H2,1-3H3<br />
}}<br />
|Section2={{Chembox Properties<br />
| Properties_ref = <ref name=Merck>''[[Merck Index]]'', 11th Edition, '''1498'''</ref><br />
| C=17 | H=26 | Cl=1 | N=1 | O=2<br />
| Appearance = Light yellow oil<br />
| Density = 1.0695 g/cm<sup>3</sup><br />
| MeltingPt = <br />
| BoilingPt = <br />
| Solubility = 20 mg/L (20 °C)<br />
}}<br />
|Section3={{Chembox Hazards<br />
| MainHazards = <br />
| FlashPtC = 100<br />
| FlashPt_notes = <ref name=SA>[http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=37887|sial&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC Butachlor] at [[Sigma-Aldrich]]</ref><br />
| AutoignitionPt = <br />
| GHSPictograms = {{GHS06}}{{GHS07}}{{GHS09}}<br />
| GHSSignalWord = Danger<br />
| HPhrases = {{H-phrases|302|317|331|400|410}}<br />
| PPhrases = {{P-phrases|261|264|270|271|272|273|280|301+312|302+352|304+340|311|321|330|333+313|363|391|403+233|405|501}}<br />
| LD50 = 1740 mg/kg (oral, rat)<ref name=Merck/><br />
}}<br />
}}<br />
<br />
'''Butachlor''' is a [[herbicide]] of the [[acetanilide]] class.<ref>{{citation | url = https://sitem.herts.ac.uk/aeru/ppdb/en/Reports/101.htm | title = PPDB| access-date = 2019-10-03}}.</ref> It is used as a selective pre-emergent herbicide.<ref name=Merck/> It is extensively used in India in the form of granules in rice as post emergence herbicide.<br />
<br />
==References==<br />
{{reflist}}<br />
<br />
{{herbicides}}<br />
<br />
[[Category:Herbicides]]<br />
[[Category:Acetanilides]]<br />
<br />
{{organic-compound-stub}}</div>
>LegionMammal978